Synonym: 3′,5′-Cyclic diadenylic acid sodium salt; Adenylyl-(3′5′)-3′-adenylic acid, cyclic nucleotide sodium salt; Cyclic di-3′,5′-adenylate sodium salt; Cyclic diadenylate monophosphate sodium salt; Cyclic diadenylate sodium salt; Cyclic-di-AMP sodium salt
CAS Number: 54447-84-6 (free acid)
Empirical Formula (Hill Notation): C20H24N10O12P2 · xNa+
Molecular Weight: 658.41 (free acid basis)
Linear Formula: C20H24N10O12P2 · xNa+
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| description |
contains 1μmol of powder (approx. 0.7mg) |
| form |
powder |
| InChI |
1S/C20H24N10O12P2/c21-15-9-17(25-3-23-15)29(5-27-9)19-11(31)13-7(39-19)1-37-43(33,34)42-14-8(2-38-44(35,36)41-13)40-20(12(14)32)30-6-28-10-16(22)24-4-26-18(10)30/h3-8,11-14,19-20,31-32H,1-2H2,(H,33,34)(H,35,36)(H2,21,23,25)(H2,22,24,26)/t7-,8-,11-,12-,13-,14-,19-,20-/m1/s1 |
| InChI key |
PDXMFTWFFKBFIN-XPWFQUROSA-N |
| Quality Level |
100  |
| SMILES string |
NC1=NC=NC2=C1N=CN2[C@H](O3)[C@H](O)[C@H](OP(OC[C@@H]4[C@@H](O5)[C@@H](O)[C@H](N6C=NC7=C6N=CN=C7N)O4)(O)=O)[C@H]3COP5(O)=O.C |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
c-di-AMP is a bacterial secondary messenger. |
| Biochem/physiol Actions: |
c-di-AMP is a bacterial secondary messenger. c-di-AMP acts as a potent mucosal adjuvant stimulating both humoral and cellular responses. |
| Biochem/physiol Actions: |
It has a role in various signaling pathways. In Gram-positive bacteria, it influences cell growth and survival and modulates virulence. c-di-AMP is formed by diadenylate cyclases (DACs), which are cyclase domain-containing proteins. |
| Preparation Note: |
c-di-AMP is soluble in water (≥ 16 mM, limits have not been determined). |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352200 |
