Synonym: (2R)-N1-[(1S)-2,2-Dimethyl-1-({[(1R)-1-phenylethyl]amino}carbonyl)propyl]-2-{3-[(3-methyl-4-phenyl)-phenyl]propyl}-(N4-hydroxy)butanediamide; UK-356,618
CAS Number: 230961-08-7
Empirical Formula (Hill Notation): C34H43N3O4
Molecular Weight: 557.72
MDL Number: MFCD19443865
Linear Formula: C34H43N3O4
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to tan |
| form |
powder |
| InChI |
1S/C34H43N3O4/c1-23-21-25(19-20-29(23)27-16-10-7-11-17-27)13-12-18-28(22-30(38)37-41)32(39)36-31(34(3,4)5)33(40)35-24(2)26-14-8-6-9-15-26/h6-11,14-17,19-21,24,28,31,41H,12-13,18,22H2,1-5H3,(H,35,40)(H,36,39)(H,37,38)/t24-,28-,31-/m1/s1 |
| InChI key |
JJHRUUKMPWUYIB-HVOSOHGQSA-N |
| optical activity |
[α]/D >+25.0°, c = 0.5 in methanol |
| Quality Level |
100  |
| SMILES string |
C[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CCCc1ccc(c(C)c1)-c2ccccc2)CC(=O)NO)C(C)(C)C)c3ccccc3 |
| solubility |
DMSO: ≥25 mg/mL |
| storage temp. |
2-8°C |
| Application: |
UK-356618 has been used as a specific matrix metalloproteinase 3 (MMP3) inhibitor to study its effect on amitriptyline-induced glial cell line-derived neurotrophic factor (GDNF) mRNA expression and to confirm its influence on amitriptyline-induced zymographic MMP-9 activation in rat C6 astroglial cells. |
| Biochem/physiol Actions: |
Selective inhibitor of matrix metalloproteinase MMP3. |
| Biochem/physiol Actions: |
UK 356618 has the potential to inhibit interleukin (IL)-6-induced cell migration in NCI H446 small cell lung cancer cells in vitro. |
| Biochem/physiol Actions: |
UK-356,618 is a potent, selective inhibitor of Matrix metalloproteinase MMP3 (stromelysin-1). MMP-3 IC50 = 5.9 nM, selectivity is 140-fold vs MMP-1, -2, -9, and -14. |
| Packaging: |
5, 25 mg in glass bottle |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H302 |
| Hazard Codes |
Xn |
| Risk Statements |
22 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
51111800 |
