Synonym: 7a,20-Epoxy-1a,6b,7,14-tetrahydroxy-Kaur-16-en-15-one; Isodonol
CAS Number: 28957-04-2
Empirical Formula (Hill Notation): C20H28O6
Molecular Weight: 364.43
Linear Formula: C20H28O6
Product Type: Chemical
| assay |
≥98% (HPLC) |
| form |
solid |
| InChI |
1S/C20H28O6/c1-9-10-4-5-11-18-8-26-20(25,19(11,14(9)22)15(10)23)16(24)13(18)17(2,3)7-6-12(18)21/h10-13,15-16,21,23-25H,1,4-8H2,2-3H3/t10-,11-,12-,13+,15+,16-,18+,19-,20+/m0/s1 |
| InChI key |
SDHTXBWLVGWJFT-XKCURVIJSA-N |
| Quality Level |
100  |
| SMILES string |
O1[C@]2([C@]43[C@H]([C@]5([C@H]([C@@H]2O)C(CC[C@@H]5O)(C)C)C1)CC[C@H]([C@H]4O)C(=C)C3=O)O |
| solubility |
DMSO: >20 mg/mL |
| |
H2O: insoluble |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
Oridonin has potent anti-tumor activity. Oridonin targets AE (AML1-ETO) oncoprotein. Exposure to oridonin induces apoptosis in AE-bearing leukemic cells through the activation of intrinsic apoptotic pathway and triggering a caspase-3-mediated degradation of AE at D188. The compound also prolonged the lifespan of C57 mice bearing truncated AE-expressing leukemic cells without side effects like suppression of bone marrow or reduction of body weight of animals, and exerted synergic effects while combined with cytosine arabinoside. Additionally, oridonin inhibited tumor growth in nude mice inoculated with t(8;21)-harboring Kasumi-1 cells. |
| Biochem/physiol Actions: |
Oridonin has potent anti-tumor activity; targets AE oncoprotein. |
| Packaging: |
5, 25 mg in glass bottle |
| Hazard Codes |
Xn |
| Risk Statements |
40 |
| Safety Statements |
36/37 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 2 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
