D-(−)-Fructose
SIGMA/F2543 - ≥99% (HPLC), BioXtra
Synonym: D-Levulose; Fruit sugar
CAS Number: 57-48-7
Empirical Formula (Hill Notation): C6H12O6
Molecular Weight: 180.16
EC Number: 200-333-3
MDL Number: MFCD00148910
Linear Formula: C6H12O6
Product Type: Chemical
| anion traces | chloride (Cl-): <0.05% |
| sulfate (SO42-): <0.05% | |
| assay | ≥99% (HPLC) |
| biological source | corn |
| cation traces | Al: <0.0005% |
| Ca: <0.0005% | |
| Cu: <0.0005% | |
| Fe: <0.0005% | |
| K: <0.005% | |
| Mg: <0.0005% | |
| Na: <0.005% | |
| NH4+: <0.05% | |
| Pb: <0.001% | |
| Zn: <0.0005% | |
| color | colorless |
| form | powder |
| ign. residue | <0.1% |
| impurities | <0.0005% Phosphorus (P) |
| <0.05% glucose (enzymatic) | |
| <0.1% Insoluble matter | |
| InChI | 1S/C6H12O6/c7-1-3(9)5(11) |
| InChI key | BJHIKXHVCXFQLS-UYFOZJQFSA |
| mp | 119-122 °C (dec.) (lit.) |
| product line | BioXtra |
| Quality Level | 200  |
| SMILES string | OC[C@@H](O)[C@@H](O)[C@H] |
| solubility | H2O: 1 M, clear, colorless |
| technique(s) | HPLC: suitable |
| useful pH range | 5.0-7.0 (25 °C, 18 g/L) |
| Application: | <ul> <li><strong>Intracellular metabolomics and microRNAomics unveil new insight into the regulatory network for potential biocontrol mechanism of stress-tolerant Tricho-fusants interacting with phytopathogen Sclerotium rolfsii Sacc.</strong>: Explores the intracellular metabolomic and microRNAomic responses in Tricho-fusants, with D-(-)-Fructose identified as a key metabolite in stress tolerance and biocontrol mechanisms (Hirpara Gajera, 2023  ).</li><li><strong>Enzyme-based amperometric biosensors: 60 years later … Quo Vadis </strong>: Reviews advancements in enzyme-based biosensors over the past six decades, including the use of D-(-)-Fructose in the development of new biosensing technologies for clinical and environmental applications (Bollella, 2022 ).</li></ul> |
| General description: | |
| Other Notes: | To gain a comprehensive understanding of our extensive range of Monosaccharides for your research, we encourage you to visit our Carbohydrates Category page. |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 100, 500 g in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99% (HPLC) |
| mp | 119-122 °C (dec.) (lit.) |
| UNSPSC | 12352201 |