6-Anilinoquinoline-5,8-quinone
SIGMA/A6563 - ≥95% (TLC), solid
Synonym: 6-
CAS Number: 91300-60-6
Empirical Formula (Hill Notation): C15H10N2O2
Molecular Weight: 250.25
MDL Number: MFCD00210756
Linear Formula: C15H10N2O2
Product Type: Chemical
| assay | ≥95% (TLC) |
| color | violet |
| form | solid |
| InChI | 1S/C15H10N2O2/c18-13-9-12 |
| InChI key | GXIJYWUWLNHKNW-UHFFFAOYSA |
| Quality Level | 200 ![]() |
| SMILES string | O=C1C=C(Nc2ccccc2)C(=O)c3 |
| solubility | 0.1 M HCl: 1 mg/mL |
| ethanol: 8 mg/mL | |
| methanol: 11 mg/mL | |
| storage temp. | 2-8°C |
| Application: | 6-Anilinoquinoline-5,8-qu |
| Biochem/physiol Actions: | Blocks cGMP production; inhibits intracellular Ca2+ release; blocks the effects of nitric oxide. Inhibits antigen-induced leukotriene release. |
| Packaging: | 5 mg in glass bottle |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥95% (TLC) |
| Storage Temp. | 2-8°C |
| UNSPSC | 41106305 |

