Acetylcholine bromide
SIGMA/A6500 - ≥99%
Synonym: ACh
CAS Number: 66-23-9
Empirical Formula (Hill Notation): C7H16BrNO2
Molecular Weight: 226.11
EC Number: 200-622-4
MDL Number: MFCD00011814
Linear Formula: (CH3)3N(Br)CH2CH2OCOCH3
Product Type: Chemical
| assay | ≥99% |
| form | powder |
| InChI | 1S/C7H16NO2.BrH/c1-7(9)10 |
| InChI key | ZEHGKSPCAMLJDC-UHFFFAOYSA |
| mp | 140-143 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | [Br-].CC(=O)OCC[N+](C)(C) |
| solubility | water: 50 mg/mL, clear, colorless to faintly yellow |
| storage temp. | −20°C |
| Application: | Acetylcholine is an endogenous neurotransmitter at cholinergic synapses that amplifies action potential of the sarcolemma thereby inducing muscle contractions. Acetylcholine bromide is used as an acetylcholine receptor agonist to identify, characterize and differentiate among types of cholinergic receptors. Acetylcholine bromide is used as an inhibitor to identify and characterize natural and mutated butyrylcholinesterase(s). |
| Biochem/physiol Actions: | Endogenous neurotransmitter at cholinergic synapses; amplifies action potential of the sarcolemma thereby inducing muscle contractions. |
| Packaging: | 100 g in poly bottle |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99% |
| mp | 140-143 °C (lit.) |
| Storage Temp. | −20°C |
| UNSPSC | 51151519 |

