2-Methoxy-2,4-diphenyl-3(2H)-furanone
SIGMA/64958 - suitable for fluorescence, ≥98.0% (HPLC)
Synonym: 2,4-
CAS Number: 50632-57-0
Empirical Formula (Hill Notation): C17H14O3
Molecular Weight: 266.29
MDL Number: MFCD00036834
Linear Formula: C17H14O3
Product Type: Chemical
| assay | ≥98.0% (HPLC) |
| fluorescence | λex 384 nm; λem 472 nm in acetonitrile (after derivatization with hexylamine) |
| form | solid |
| InChI | 1S/C17H14O3/c1-19-17(14-1 |
| InChI key | BLWINLJDTOJSRU-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | COC1(OC=C(C1=O)c2ccccc2)c |
| storage temp. | 2-8°C |
| suitability | suitable for fluorescence |
| Application: | 2-Methoxy-2,4-diphenyl-3( |
| Other Notes: | Reagent for the derivatization of primary and secondary amines for HPLC; highly fluorescent derivatives are formed; Pre-column derivatization of amines; Fluorescent labeling of proteins before SDS-PAGE |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98.0% (HPLC) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352108 |


