D-Mannitol
SIGMA/63559 - BioUltra, ≥99.0% (sum of enantiomers, HPLC)
Synonym: Mannite
CAS Number: 69-65-8
Empirical Formula (Hill Notation): C6H14O6
Molecular Weight: 182.17
EC Number: 200-711-8
MDL Number: MFCD00064287
Linear Formula: C6H14O6
Product Type: Chemical
| λ | 1 M in H2O |
| anion traces | chloride (Cl-): ≤50 mg/kg |
| sulfate (SO42-): ≤50 mg/kg | |
| assay | ≥99.0% (sum of enantiomers, HPLC) |
| cation traces | Al: ≤5 mg/kg |
| As: ≤0.1 mg/kg | |
| Ba: ≤5 mg/kg | |
| Bi: ≤5 mg/kg | |
| Ca: ≤10 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Li: ≤5 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Mo: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤1 mg/kg | |
| Pb: ≤1 mg/kg | |
| Sr: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| color | white |
| form | powder |
| ign. residue | ≤0.01% (as SO4) |
| impurities | insoluble matter, passes filter test |
| reducing sugars, complies | |
| ≤0.0072% free acid (as CH3COOH) | |
| InChI | 1S/C6H14O6/c7-1-3(9)5(11) |
| InChI key | FBPFZTCFMRRESA-KVTDHHQDSA |
| loss | ≤0.05% loss on drying, 20 °C (HV) |
| mp | 166-168 °C |
| 167-170 °C (lit.) | |
| optical activity | [α]20/D +24.0±1° in borax solution acc. to Ph Eur |
| pH | 5.0-6.5 (25 °C, 1 M in H2O) |
| product line | BioUltra |
| Quality Level | 200  |
| SMILES string | OC[C@@H](O)[C@@H](O)[C@H] |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| UV absorption | λ: 260 nm Amax: 0.04 |
| λ: 280 nm Amax: 0.04 |
| Application: | D-Mannitol is used as an osmolyte and transport facilitator in a variety of biological in vivo and in vitro applications, such as improvement of blood-brain barrier transport and hyperosmolar therapy. D-Mannitol is used as a substrate to identify, differentiate and characterized enzymes such as mannitol dehydrogenase(s). D-Mannitol is used in identify mannitol metabolizing bacteria. |
| Biochem/physiol Actions: | A sugar alcohol sweet tastant. Used in sweetness inhibition studies. |
| Other Notes: | To gain a comprehensive understanding of our extensive range of Sugar alcohols for your research, we encourage you to visit our Carbohydrates Category page. |
| Other Notes: | Used in discontinuous gradient centrifugation for purification of plant protoplasts. Plasmolyticum that reversibly inhibits phenylalanine ammonia-lyase activity of protoplasts at concentrations exceeding 50 mM. Component of the liquid stationary phase in the GLC separation of nitroxylene and xylenol isomers. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Purity | ≥99.0% (sum of enantiomers, HPLC) |
| mp | 166-168 °C; 167-170 °C (lit.) |
| UNSPSC | 12352201 |