L-Histidine
SIGMA/53319 - BioUltra, ≥99.5% (NT)
Synonym: (S)
CAS Number: 71-00-1
Empirical Formula (Hill Notation): C6H9N3O2
Molecular Weight: 155.15
EC Number: 200-745-3
MDL Number: MFCD00064315
Linear Formula: C6H9N3O2
Product Type: Chemical
| λ | 0.1 M in H2O |
| anion traces | chloride (Cl-): ≤100 mg/kg |
| sulfate (SO42-): ≤100 mg/kg | |
| application(s) | detection |
| assay | ≥99.5% (NT) |
| cation traces | Al: ≤5 mg/kg |
| As: ≤0.1 mg/kg | |
| Ba: ≤5 mg/kg | |
| Bi: ≤5 mg/kg | |
| Ca: ≤10 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Li: ≤5 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Mo: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| NH4+: ≤500 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Sr: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| color | white |
| form | powder or crystals |
| ign. residue | ≤0.1% (as SO4) |
| impurities | insoluble matter, passes filter test |
| ≤0.5% foreign amino acids | |
| InChI | 1S/C6H9N3O2/c7-5(6(10)11) |
| InChI key | HNDVDQJCIGZPNO-YFKPBYRVSA |
| loss | ≤0.5% loss on drying, 110 °C |
| mp | 282 °C (dec.) (lit.) |
| ~285 °C (dec.) | |
| optical activity | [α]20/D −39±1°, c = 2% in H2O |
| pH | 7.0-8.0 (25 °C, 0.1 M in H2O) |
| product line | BioUltra |
| Quality Level | 200  |
| SMILES string | N[C@@H](Cc1c[nH]cn1)C(O)= |
| solubility | H2O: 0.1 M at 20 °C, clear, colorless |
| UV absorption | λ: 260 nm Amax: 0.05 |
| λ: 280 nm Amax: 0.05 |
| Application: | L-Histidine has been used for characterization of ZnO nanorod in an attempt to develop a technique for the ultra-low level detection of l-histidine. |
| Biochem/physiol Actions: | L-Histidine is involved in the one-carbon unit metabolism. It is associated with protein methylation. L-Histidine is a part of hemoglobin structure and function. L-Histidine is a component of dipeptides with antioxidative property. Histidine serves as a precursor for the formation of histamine, which is associated with allergic responses. Urocanic acid, an immune response modulator in skin is also biosynthesised from histidine. |
| Biochem/physiol Actions: | Precursor of histamine by action of histidine decarboxylase. |
| Other Notes: | Amino acid spacing in isotachophoresis on polyacrylamide gels - a critical evaluation; Prevents circular DNA strand cleavage in a xanthine-xanthine oxidase system; Growth requirement of various microorganisms. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.5% (NT) |
| mp | 282 °C (dec.) (lit.); ~285 °C (dec.) |
| UNSPSC | 12352209 |