Synonym: 3,5-Bis(glucosyloxy)-4′,7-dihydroxyflavylium chloride; Monardin; Pelargonidin 3,5-di-O-glucoside chloride
CAS Number: 17334-58-6
Empirical Formula (Hill Notation): C27H31ClO15
Molecular Weight: 630.98
EC Number: 241-360-0
MDL Number: MFCD21363968
Linear Formula: C27H31ClO15
Product Type: Chemical
| assay |
≥90% (HPLC) |
| biological source |
synthetic |
| form |
powder |
| InChI |
1S/C27H30O15.ClH/c28-8-17-19(32)21(34)23(36)26(41-17)39-15-6-12(31)5-14-13(15)7-16(25(38-14)10-1-3-11(30)4-2-10)40-27-24(37)22(35)20(33)18(9-29)42-27;/h1-7,17-24,26-29,32-37H,8-9H2,(H-,30,31);1H/t17-,18-,19-,20-,21+,22+,23-,24-,26-,27-;/m1./s1 |
| InChI key |
DIRROHKULXIUCB-DHJOXOLYSA-N |
| Quality Level |
100  |
| SMILES string |
[Cl-].OC[C@H]1O[C@@H](Oc2cc3c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc(O)cc3[o+]c2-c5ccc(O)cc5)[C@H](O)[C@@H](O)[C@@H]1O |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
Pelargonin is an anthocyanin, which are present in fruits and vegetables as natural colorants. It was found in dates and investigated for anti-allergic properties. It shows some oxygen radical absorbance capacity |
| Biochem/physiol Actions: |
The phytoestrogen pelargonin, also known as pelargonidin, is a common anthocyanin which displays antioxidant and antigenotoxic properties. |
| Packaging: |
Bottomless glass bottle. Contents are inside inserted fused cone. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥90% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352201 |
