Trichlorfon
SIGMA/45698 - PESTANAL®, analytical standard
Synonym: (2,2,2-
CAS Number: 52-68-6
Empirical Formula (Hill Notation): C4H8Cl3O4P
Molecular Weight: 257.44
EC Number: 200-149-3
MDL Number: MFCD00055272
Linear Formula: C4H8Cl3O4P
Product Type: Chemical
| application(s) | agriculture environmental |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C4H8Cl3O4P/c1-10-12(9, |
| InChI key | NFACJZMKEDPNKN-UHFFFAOYSA |
| product line | PESTANAL® |
| Quality Level | 100 ![]() |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | COP(=O)(OC)C(O)C(Cl)(Cl)C |
| storage temp. | 2-8°C |
| Biochem/physiol Actions: | Trichlorfon also known as metrifonate, is an insecticide that functions as an inhibitor of acetylcholine esterase. Trichlorfon has been shown to induce DNA damage and genetic defects in numerous cell lines in addition to inducing aneuploidy in male mouse germ cells. |
| Legal Information: | PESTANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Symbol | ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302 + H312 - H317 - H334 - H410 |
| Precautionary statements | P273 - P280 - P301 + P312 + P330 - P302 + P352 + P312 |
| Hazard Codes | Xn,N |
| Risk Statements | 21/22-42/43-50/53 |
| Safety Statements | 24-37-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | 2-8°C |
| UNSPSC | 41116107 |




