Erythrosin extra bluish
SIGMA/45690 - suitable for microscopy
Synonym: 2′,4′,5′,7′-Tetraiodofluorescein disodium salt; Acid Red 51; Iodoeosin
CAS Number: 16423-68-0
Empirical Formula (Hill Notation): C20H6I4Na2O5
Molecular Weight: 879.86
EC Number: 240-474-8
MDL Number: MFCD00144257
Linear Formula: C20H6I4Na2O5
Product Type: Chemical
| form | solid |
| InChI | 1S/C20H8I4O5.2Na/c21-11-5 |
| InChI key | RAGZEDHHTPQLAI-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | [Na+].[Na+].[O-]c1c(I)cc2 |
| suitability | suitable for microscopy |
| technique(s) | titration: suitable |
| General description: | Erythrosin extra bluish is a brown color powder, that is soluble in ethanol and water. Its pH ranges from 2.5 to 4. It is used in color filters, light emitting diodes, cosmetics, hair dyes etc. It has several biological applications like detecting gene expression, treating age related macular degeneration, diabetes, obesity etc. |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H413 |
| Precautionary statements | P301 + P312 + P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 359.6 °F - closed cup |
| Flash Point(C) | 182 °C - closed cup |
| Colour Index Number | 45430 |
| UNSPSC | 12171500 |


