Dimidium bromide
SIGMA/41785 - BioReagent, suitable for fluorescence, ~95% (AT)
Synonym: 3,8-
CAS Number: 518-67-2
Empirical Formula (Hill Notation): C20H18BrN3
Molecular Weight: 380.28
EC Number: 208-256-7
MDL Number: MFCD00011757
Linear Formula: C20H18BrN3
Product Type: Chemical
| assay | ~95% (AT) |
| fluorescence | λex 306 nm; λem 612 nm in 50 mM Tris pH 8.0 (DNA) |
| λex 480 (pH 7.6, low ionic strength) | |
| form | solid |
| InChI | 1S/C20H17N3.BrH/c1-23-19- |
| InChI key | MQOKYEROIFEEBH-UHFFFAOYSA |
| mp | 243-248 °C (lit.) |
| product line | BioReagent |
| Quality Level | 100 ![]() |
| SMILES string | [Br-].C[n+]1c(-c2ccccc2)c |
| suitability | suitable for fluorescence |
| Application: | Dimidium Bromide is used as a binding agent to natural DNA based on base-pair specificity. It is used as a fluorescence agent for nucleic acid experiments. |
| Application: | Intercalating probe for nucleic acids. |
| General description: | Dimidium Bromide is a trypanocidal drug that is known to affect nucleic acid synthesis in many organisms e.g. tissue culture cells. |
| Packaging: | 1 g in glass bottle |
| Packaging: | 250 mg in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ~95% (AT) |
| mp | 243-248 °C (lit.) |
| UNSPSC | 12171500 |


