Solanidine
SIGMA/13264 - ≥97.0% (HPLC)
Synonym: (3β)-Solanid-5-en-3-ol; Solatubine
CAS Number: 80-78-4
Empirical Formula (Hill Notation): C27H43NO
Molecular Weight: 397.64
EC Number: 201-309-5
MDL Number: MFCD00056839
Linear Formula: C27H43NO
Product Type: Chemical
| assay | ≥97.0% (HPLC) |
| form | powder or crystals |
| InChI | 1S/C27H43NO/c1-16-5-8-23- |
| InChI key | JVKYZPBMZPJNAJ-OQFNDJACSA |
| Quality Level | 100 ![]() |
| SMILES string | C[C@H]1CC[C@@H]2[C@@H](C) |
| storage temp. | room temp |
| technique(s) | HPLC: suitable |
| Biochem/physiol Actions: | A poisonous steroid alkaloid derived from cholesterol and L-Arginine that is present in plants of the Solanaceae family. Solanidine is an inhibitor of serum cholinesterases in humans. |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| Symbol | ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302 - H361d - H413 |
| Precautionary statements | P202 - P264 - P270 - P273 - P301 + P312 - P308 + P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-53 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Purity | ≥97.0% (HPLC) |
| Storage Temp. | room temp |
| UNSPSC | 12352201 |



