Ammonium persulfate
SIGMA/09913 - BioUltra, for molecular biology, ≥98.0% (RT)
Synonym: AP; APS; Ammonium peroxodisulfate; Ammonium peroxydisulfate; PER
CAS Number: 7727-54-0
Empirical Formula (Hill Notation): H8N2O8S2
Molecular Weight: 228.20
EC Number: 231-786-5
MDL Number: MFCD00003390
Linear Formula: (NH4)2S2O8
Product Type: Chemical
| absorption | cut-off at 308 nm in H2O at 1 M |
| anion traces | chloride (Cl-): ≤5 mg/kg |
| assay | ≥98.0% (RT) |
| cation traces | Al: ≤5 mg/kg |
| As: ≤0.1 mg/kg | |
| Ba: ≤5 mg/kg | |
| Bi: ≤5 mg/kg | |
| Ca: ≤10 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤10 mg/kg | |
| Li: ≤5 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Mo: ≤5 mg/kg | |
| Na: ≤500 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Sr: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| grade | for molecular biology |
| ign. residue | ≤0.05% (as SO4) |
| impurities | insoluble matter, passes filter test |
| phosphatases, none detected | |
| proteases, none detected | |
| InChI | 1S/2H3N.H2O8S2/c;;1-9(2,3 |
| InChI key | ROOXNKNUYICQNP-UHFFFAOYSA |
| pH | 1.0-2.5 (25 °C, 1 M in H2O) |
| product line | BioUltra |
| Quality Level | 200  |
| SMILES string | N.N.OS(=O)(=O)OOS(O)(=O)= |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| suitability | in accordance for electrophoresis test |
| technique(s) | electrophoresis: suitable |
| vapor density | 7.9 (vs air) |
| Application: | Ammonium persulfate is a strong oxidizing agent frequently used with tetramethylethylenediamin |
| Application: | Catalyst for acrylamide gel polymerization. |
| Other Notes: | Preparation of polyacrylamide gels - polymerization catalyst |
| Symbol |    GHS03,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H272 - H302 - H315 - H317 - H319 - H334 - H335 |
| Precautionary statements | P210 - P280 - P301 + P312 + P330 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | O,Xn |
| Risk Statements | 8-22-36/37/38-42/43 |
| Safety Statements | 22-24-26-37 |
| RIDADR | UN 1444 5.1 / PGIII |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98.0% (RT) |
| UNSPSC | 12352201 |