Synonym: 4,5-Diamino-N,N,N′,N′-tetraethylrhodamine; 4,5-Diamino-rhodamine B
CAS Number: 261351-43-3
Empirical Formula (Hill Notation): C28H32N4O3
Molecular Weight: 472.58
MDL Number: MFCD07370097
Linear Formula: C28H32N4O3
Product Type: Chemical
| assay |
≥97.0% (HPCE) |
| fluorescence |
λex 566 nm; λem 586 nm in 0.1 M phosphate pH 7.4, NO |
| form |
powder |
| InChI |
1S/C28H32N4O3/c1-5-31(6-2)17-9-11-19-23(15-17)34-24-16-18(32(7-3)8-4)10-12-20(24)28(19)21-13-14-22(29)26(30)25(21)27(33)35-28/h9-16H,5-8,29-30H2,1-4H3 |
| InChI key |
LFXDWSUQAVSSJH-UHFFFAOYSA-N |
| product line |
BioReagent |
| Quality Level |
100  |
| SMILES string |
CCN(CC)c1ccc2c(Oc3cc(ccc3C24OC(=O)c5c(N)c(N)ccc45)N(CC)CC)c1 |
| storage temp. |
2-8°C |
| suitability |
suitable for fluorescence |
| Application: |
suitable as fluorescent NO-sensor |
| Other Notes: |
Sensitive fluorescent indicator for nitric oxide, NO, based on rhodamine chromophore; LOD in the region of 10 nM; it is more photostable and emits at longer wave-length than the corresponding derivative of fluorescein (DAF, Cat. No. 41524) |
| Symbol |
GHS07 |
| Signal word |
Warning |
| Hazard statements |
H302 |
| Precautionary statements |
P264 - P270 - P301 + P312 - P501 |
| Hazard Codes |
Xn |
| Risk Statements |
22 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥97.0% (HPCE) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352111 |