Magnesium L-pidolate
SIGMA/08114 - 98.0-102.0% (calc. on dry substance, T)
Synonym: MAG2; Magnesium (S)
CAS Number: 62003-27-4
Empirical Formula (Hill Notation): C10H12N2MgO6
Molecular Weight: 280.52
EC Number: 263-365-7
MDL Number: MFCD00792303
Linear Formula: C10H12N2MgO6
Product Type: Chemical
| anion traces | chloride (Cl-): ≤500 mg/kg |
| nitrate (NO3-): ≤50 mg/kg | |
| phosphate (PO43-): ≤50 mg/kg | |
| sulfate (SO42-): ≤200 mg/kg | |
| assay | 98.0-102.0% (calc. on dry substance, T) |
| cation traces | Ag: ≤5 mg/kg |
| Al: ≤5 mg/kg | |
| As: ≤0.5 mg/kg | |
| Ba: ≤5 mg/kg | |
| Be: ≤5 mg/kg | |
| Bi: ≤5 mg/kg | |
| Ca: ≤50 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤10 mg/kg | |
| Li: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Mo: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Sr: ≤5 mg/kg | |
| Ti: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| Zr: ≤5 mg/kg | |
| InChI | 1S/2C5H7NO3.Mg/c2*7-4-2-1 |
| InChI key | JQAACYUZYRBHGG-QHTZZOMLSA |
| optical activity | [α]/D -24±1.5°, c = 0.5 in H2O |
| pH | 5.5-7.5 (25 °C, 50 mg/mL in H2O) |
| Quality Level | 100  |
| SMILES string | O=C1CC[C@H](N1)C(=O)O[Mg] |
| solubility | H2O: 50 mg/mL, clear, colorless |
| Application: | Magnesium L-pidolate, or MAG2, has been used in a study to inform radiopharmaceuticals for diagnostic imaging of breast cancer. MAG2 has also been used in a study to assess the influence of the bifunctional chelate on the biological behavior of 99mtc-labeled chemotactic peptide conjugates. MAG2 has also been used in a study to learn more about the antimicrobial peptides from the skin secretions of amphibians. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98.0-102.0% (calc. on dry substance, T) |
| UNSPSC | 12352204 |