Amiprofos methyl
SIGMA/03992 - PESTANAL®, analytical standard
Synonym: O-Methyl O-(2-nitro-p-tolyl) N-
CAS Number: 36001-88-4
Empirical Formula (Hill Notation): C11H17N2O4PS
Molecular Weight: 304.30
EC Number: 252-829-4
MDL Number: MFCD00467096
Linear Formula: C11H17N2O4PS
Product Type: Chemical
| application(s) | agriculture environmental |
| assay | ≥98% (GC) |
| form | powder or crystals |
| format | neat |
| grade | analytical standard |
| reference material | |
| InChI | 1S/C11H17N2O4PS/c1-8(2)12 |
| InChI key | VHEWQRWLIDWRMR-UHFFFAOYSA |
| mp | ~65 °C |
| product line | PESTANAL® |
| Quality Level | 100  |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | COP(=S)(NC(C)C)Oc1ccc(C)c |
| storage temp. | 2-8°C |
| Biochem/physiol Actions: | Herbicide that prevents microtubule polymerization in plant cells, but not animal cells. Crop plants resistant to amiprofos-methyl and several other herbicides have been developed by insertion of a xenobiotic-detoxifying human gene CYP2B6. |
| Legal Information: | PESTANAL is a registered trademark of Sigma-Aldrich International GmbH |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (GC) |
| mp | ~65 °C |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352202 |