Triethyl citrate
SIAL/W308302 - natural, ≥99%, FG
Synonym: Ethyl citrate
CAS Number: 77-93-0
Empirical Formula (Hill Notation): C12H20O7
Molecular Weight: 276.28
EC Number: 201-070-7
MDL Number: MFCD00009201
Linear Formula: HOC(COOC2H5)(CH2COOC2H5)2
Product Type: Chemical
| agency | follows IFRA guidelines |
| meets purity specifications of JECFA | |
| application(s) | flavors and fragrances |
| assay | ≥99% |
| bp | 235 °C/150 mmHg (lit.) |
| density | 1.14 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| fragrance allergen | no known allergens |
| grade | FG |
| Fragrance grade | |
| Halal | |
| Kosher | |
| natural | |
| InChI | 1S/C12H20O7/c1-4-17-9(13) |
| InChI key | DOOTYTYQINUNNV-UHFFFAOYSA |
| mp | -55 °C |
| organoleptic | odorless |
| Quality Level | 300  |
| refractive index | n |
| reg. compliance | EU Regulation 1223/2009 |
| EU Regulation 1334/2008 & 178/2002 | |
| FDA 21 CFR 117 | |
| SMILES string | CCOC(=O)CC(O)(CC(=O)OCC)C |
| vapor density | 9.7 (vs air) |
| vapor pressure | 1 mmHg ( 107 °C) |
| Application: | Triethyl citrate is used as a food additive to stabilize foams, particularly egg whites. |
| General description: | Triethyl citrate is an ester of citric acid, commonly used as an emulsifier and flavor preservative in the food industry. It is recognized as a safe direct food additive. |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 5 kg in poly drum |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 311.0 °F - closed cup |
| Flash Point(C) | 155 °C - closed cup |
| Purity | ≥99% |
| bp | 235 °C/150 mmHg (lit.) |
| mp | -55 °C |
| Density | 1.14 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| FEMA Number | 3083 |
| UNSPSC | 12164502 |