Synonym: 1,2,3-Tri-(cis,cis-9,12-octadecadienoyl)glycerol; 1,2,3-Trilinoleoylglycerol; Glycerol trilinoleate; Trilinolein
CAS Number: 537-40-6
Empirical Formula (Hill Notation): C57H98O6
Molecular Weight: 879.38
EC Number: 208-666-6
MDL Number: MFCD00042909
Linear Formula: C57H98O6
Product Type: Chemical
| application(s) |
food and beverages |
| assay |
≥97.5% (GC) |
| |
≥97.5% (TLC) |
| density |
0.925 g/mL at 20 °C (lit.) |
| format |
neat |
| functional group |
ester |
| grade |
analytical standard |
| impurities |
≤0.5% water |
| InChI |
1S/C57H98O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h16-21,25-30,54H,4-15,22-24,31-53H2,1-3H3/b19-16-,20-17-,21-18-,28-25-,29-26-,30-27- |
| InChI key |
HBOQXIRUPVQLKX-BBWANDEASA-N |
| Quality Level |
100  |
| refractive index |
n20/D 1.478-1.480 |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
CCCCCC=C/CC=C/CCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=C/CC=C/CCCCC)OC(=O)CCCCCCCC=C/CC=C/CCCCC |
| storage temp. |
−20°C |
| technique(s) |
gas chromatography (GC): suitable |
| |
HPLC: suitable |
| Application: |
Glyceryl trilinoleate may be used as one of the standard for evaluating the kinetics of blackcurrant seed oil lipolysis in supercritical carbon dioxide by reversed phase high-performance liquid chromatography method. |
| Application: |
Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Hazard statements |
H413 |
| Precautionary statements |
P273 - P501 |
| Risk Statements |
53 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
awg |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥97.5% (GC); ≥97.5% (TLC) |
| Density |
0.925 g/mL at 20 °C (lit.) |
| Refractive Index |
n20/D 1.478-1.480 |
| Storage Temp. |
−20°C |
| UNSPSC |
85151701 |
