Farnesol
SIAL/93547 - mixture of isomers, analytical standard
Synonym: 3,7,11-
CAS Number: 4602-84-0
Empirical Formula (Hill Notation): C15H26O
Molecular Weight: 222.37
EC Number: 225-004-1
MDL Number: MFCD00002918
Linear Formula: (CH3)2C=CHCH2CH2C(CH3)=CHCH2CH2C(CH3)=CHCH2OH
Product Type: Chemical
| application(s) | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| bp | 149 °C/4 mmHg (lit.) |
| composition | 2E,6E, 62.0-72.0% GC |
| 2E,6Z, 12.0-18.0% GC | |
| 2Z,6E, 8.0-12.0% GC | |
| 2Z,6Z, 4.0-6.0% GC | |
| density | 0.886 g/mL at 20 °C (lit.) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C15H26O/c1-13(2)7-5-8- |
| InChI key | CRDAMVZIKSXKFV-YFVJMOTDSA |
| refractive index | n |
| n |
|
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | C/C(CC/C=C(C)/CCC=C(C)C)= |
| Symbol |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315 - H317 - H410 |
| Precautionary statements | P261 - P264 - P272 - P273 - P280 - P302 + P352 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | WGK 2 |
| Flash Point(F) | 311.0 °F - closed cup |
| Flash Point(C) | 155 °C - closed cup |
| bp | 149 °C/4 mmHg (lit.) |
| Density | 0.886 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 41116107 |