Synonym: rel-(3aR,4R,6aS)-N-[19-Azido-15-(4,4-dimethyl-2,6-dioxocyclohexylidene)-3,6,9,12-tetraoxa-16-azanonadec-1-yl]hexahydro-2-oxo-1H-thieno[3,4-d]imidazole-4-pentanamide
CAS Number: 1802907-93-2
Empirical Formula (Hill Notation): C32H53N7O8S
Molecular Weight: 695.87
MDL Number: MFCD28505550
Linear Formula: C32H53N7O8S
Product Type: Chemical
| form |
liquid |
| InChI |
1S/C32H53N7O8S/c1-32(2)20-25(40)29(26(41)21-32)23(34-9-5-10-36-39-33)8-12-44-14-16-46-18-19-47-17-15-45-13-11-35-28(42)7-4-3-6-27-30-24(22-48-27)37-31(43)38-30/h24,27,30,34H,3-22H2,1-2H3,(H,35,42)(H2,37,38,43)/t24-,27-,30-/m0/s1 |
| InChI key |
HUAWNOKWZYCBQA-LFERIPGTSA-N |
| reaction suitability |
reaction type: click chemistry |
| SMILES string |
S1[C@H]([C@H]3NC(=O)N[C@H]3C1)CCCCC(=O)NCCOCCOCCOCCOCCC(=C2C(=O)CC(CC2=O)(C)C)NCCCN=[N+]=[N-] |
| storage temp. |
−20°C (−15°C to −25°C) |
| Application: |
Extraordinary strength of the streptavidin-biotin interaction allows for efficient capturing of even highly dilute targets; however, it makes recovery of proteins from affinity resins challenging. This reagent contains a biotin moiety linked to an azide moiety through a spacer arm containing a hydrazine-cleavable Dde linker. Typically >90% of captured biomolecules can be efficiently released. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Storage Temp. |
−20°C (−15°C to −25°C) |
| UNSPSC |
12352125 |
