Tetrahexylammonium hydrogensulfate
SIAL/87299 - suitable for ion pair chromatography, LiChropur™, ≥99.0% (T)
CAS Number: 32503-34-7
Empirical Formula (Hill Notation): C24H53NO4S
Molecular Weight: 451.75
EC Number: 251-069-0
MDL Number: MFCD00037675
Linear Formula: [CH3(CH2)5]4N(HSO4)
Product Type: Chemical
| λ | 10 % in acetonitrile |
| assay | ≥99.0% (T) |
| description | cationic |
| form | crystals |
| InChI | 1S/C24H52N.H2O4S/c1-5-9-1 |
| InChI key | RULHPTADXJPDSN-UHFFFAOYSA |
| mp | 98-100 °C (lit.) |
| 99-102 °C | |
| quality | LiChropur™ |
| Quality Level | 100  |
| SMILES string | OS([O-])(=O)=O.CCCCCC[N+] |
| suitability | corresponds to standard for filter test |
| corresponds to standard for RP gradient test | |
| technique(s) | ion pair chromatography: suitable |
| UV absorption | λ: 210 nm Amax: 0.10 |
| λ: 220 nm Amax: 0.04 | |
| λ: 230 nm Amax: 0.03 | |
| λ: 260 nm Amax: 0.02 | |
| λ: 500 nm Amax: 0.02 |
| Application: | Tetrahexylammonium hydrogensulfate may have been used as a phase-transfer catalyst during catalysis analysis of benzylic halide to carboxylic acid. |
| General description: | Tetrahexylammonium hydrogensulfate is a quaternary ammonium salt mainly used as an electrolyte. |
| Legal Information: | LiChropur is a trademark of Merck KGaA, Darmstadt, Germany |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (T) |
| mp | 98-100 °C (lit.); 99-102 °C |
| UNSPSC | 23151817 |