Synonym: 1,4-Diphenyl-3-phenylamino-1,2,4-triazolium hydroxide inner salt; 3,5,6-Triphenyl-2,3,5,6-tetraazabicyclo[2.1.1]hex-1-ene; 4,5-Dihydro-2,4-diphenyl-5-(phenylimino)-1H-1,2,4-triazolium hydroxide inner salt
CAS Number: 2218-94-2
Empirical Formula (Hill Notation): C20H16N4
Molecular Weight: 312.37
EC Number: 218-724-2
MDL Number: MFCD00005174
Linear Formula: C20H16N4
Product Type: Chemical
| assay |
≥97.0% |
| |
≥97.0% (NT) |
| form |
solid |
| impurities |
≤3% water |
| InChI |
1S/C20H16N4/c1-4-10-17(11-5-1)21-20-22-24(19-14-8-3-9-15-19)16-23(20)18-12-6-2-7-13-18/h1-16H |
| InChI key |
CWGBFIRHYJNILV-UHFFFAOYSA-N |
| mp |
189-190 °C (dec.) (lit.) |
| quality |
for spectrophotometric det. of nitrate and perchlorate |
| Quality Level |
100  |
| SMILES string |
[N-]1N(C=[N+](c2ccccc2)C1=Nc3ccccc3)c4ccccc4 |
| technique(s) |
UV/Vis spectroscopy: suitable |
| Application: |
For spectrophotometric determination of nitrate and perchlorate |
| Other Notes: |
Reagent for the precipitation of anions; reagent for the spectrophotometric determination of nitrate and perchlorate by a difference method; Reagent for the determination of traces of gold |
| Packaging: |
5, 50 g in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥97.0% (NT); ≥97.0% |
| mp |
189-190 °C (dec.) (lit.) |
| UNSPSC |
23151817 |
