Acrylamide-d3 Standard solution
SIAL/72834 - ~500 mg/L in acetonitrile, analytical standard
CAS Number: 122775-19-3
EC Number: 200-835-2
MDL Number: MFCD00143546
Product Type: Chemical
This image is provided for informative purposes only and does not represent an actual product label. It should not be used as a substitute for official product labeling.
| concentration | ~500 mg/L in acetonitrile |
| format | single component solution |
| grade | analytical standard |
| InChI | 1S/C3H5NO/c1-2-3(4)5/h2H, |
| InChI key | HRPVXLWXLXDGHG-FUDHJZNOSA |
| Quality Level | 100  |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | NC(=O)C(=C([2H])[2H])[2H] |
| storage temp. | 2-8°C |
| Application: | Acrylamide-d3 may be used as an internal standard during the determination of acrylamide in cocoa and coffee products using liquid chromatography–tandem mass spectrometry. |
| General description: | Acrylamide-d3 is isotopically labelled or deuterated acrylamide and is mostly used in quantitative proteomics. It has 3 deuteriums instead of protons making it heavier than acrylamide. It can be combined with two-dimensional polyacrylamide gel electrophoresis. |
| Symbol |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225 - H302 + H312 + H332 - H319 |
| Precautionary statements | P210 - P280 - P301 + P312 - P303 + P361 + P353 - P304 + P340 + P312 - P305 + P351 + P338 |
| Hazard Codes | F,Xn |
| Risk Statements | 11-20/21/22-36 |
| Safety Statements | 16-36/37 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | WGK 2 |
| Flash Point(F) | 35.6 °F - closed cup |
| Flash Point(C) | 2 °C - closed cup |
| Storage Temp. | 2-8°C |
| UNSPSC | 12164500 |