Synonym: α-Lnn; cis,cis,cis-9,12,15-Octadecatrienoic acid
CAS Number: 463-40-1
Empirical Formula (Hill Notation): C18H30O2
Molecular Weight: 278.43
EC Number: 207-334-8
MDL Number: MFCD00065720
Linear Formula: CH3(CH2CH=CH)3(CH2)7CO2H
Product Type: Chemical
| application(s) |
food and beverages |
| assay |
≥98.5% (GC) |
| bp |
230-232 °C/1 mmHg (lit.) |
| density |
0.914 g/mL at 25 °C (lit.) |
| format |
neat |
| functional group |
carboxylic acid |
| |
oleic acid |
| grade |
analytical standard |
| InChI |
1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9- |
| InChI key |
DTOSIQBPPRVQHS-PDBXOOCHSA-N |
| mp |
-11 °C (lit.) |
| Quality Level |
100  |
| refractive index |
n20/D 1.480 |
| |
n20/D 1.480 (lit.) |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
CC/C=CC/C=CC/C=CCCCCCCCC(O)=O |
| storage temp. |
−20°C |
| technique(s) |
gas chromatography (GC): suitable |
| |
HPLC: suitable |
| Application: |
Linolenic acid has been used in the semisynthesis of lipo-alkaloids derived from aconitine, which may act as anti-inflammatory agents. |
| Application: |
Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Biochem/physiol Actions: |
An ω-3 fatty acid that serves as a precursor to eicosapentaenoic acid (EPA) but not docosahexaenoic acid. Conversion is greater in women than men, and conversely, β-oxidation metabolism is greater in men than women. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 1 |
| Flash Point(F) |
235.4 °F - closed cup |
| Flash Point(C) |
113 °C - closed cup |
| Purity |
≥98.5% (GC) |
| bp |
230-232 °C/1 mmHg (lit.) |
| mp |
-11 °C (lit.) |
| Density |
0.914 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.480 (lit.); n20/D 1.480 |
| Storage Temp. |
−20°C |
| UNSPSC |
85151701 |
