D-Camphor
SIAL/50843 - analytical standard
Synonym: 2-Bornanone; 2-Camphanone
CAS Number: 464-49-3
Empirical Formula (Hill Notation): C10H16O
Molecular Weight: 152.23
EC Number: 207-355-2
MDL Number: MFCD00064149
Linear Formula: C10H16O
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 50843-100MG
| application(s) | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| assay | ≥97.5% (GC) |
| autoignition temp. | 870 °F |
| expl. lim. | 3.5 % |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C10H16O/c1-9(2)7-4-5-1 |
| InChI key | DSSYKIVIOFKYAU-XCBNKYQSSA |
| mp | 178-182 °C (lit.) |
| optical activity | [α]/D +43.0±2.0°, c = 10 in ethanol |
| Quality Level | 100  |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CC1(C)[C@@H]2CC[C@@]1(C)C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable | |
| vapor density | 5.24 (vs air) |
| vapor pressure | 4 mmHg ( 70 °C) |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: |
| Symbol |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H228 - H315 - H319 - H335 |
| Precautionary statements | P210 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | F,Xn |
| Risk Statements | 11-22-36/37/38 |
| Safety Statements | 16-26 |
| RIDADR | UN 2717 4.1 / PGIII |
| WGK Germany | WGK 1 |
| Flash Point(F) | 150.8 °F |
| Flash Point(C) | 66 °C |
| Purity | ≥97.5% (GC) |
| mp | 178-182 °C (lit.) |
| UNSPSC | 85151701 |