D-(−)-Fructose
SIAL/47740 - ≥99.0% (HPLC), suitable for microbiology
Synonym: D-Levulose; Fruit sugar
CAS Number: 57-48-7
Empirical Formula (Hill Notation): C6H12O6
Molecular Weight: 180.16
EC Number: 200-333-3
MDL Number: MFCD00148910
Linear Formula: C6H12O6
Product Type: Chemical
| anion traces | chloride (Cl-): ≤50 mg/kg |
| sulfate (SO42-): ≤50 mg/kg | |
| application(s) | microbiology |
| assay | ≥99.0% (HPLC) |
| cation traces | As: ≤0.1 mg/kg |
| Ca: ≤10 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| form | powder |
| ign. residue | ≤0.1% (as SO4) |
| InChI | 1S/C6H12O6/c7-1-3(9)5(11) |
| InChI key | BJHIKXHVCXFQLS-UYFOZJQFSA |
| loss | ≤0.1% loss on drying, 20 °C (HV) |
| mp | 119-122 °C (dec.) (lit.) |
| optical activity | [α]20/D −92±2°, 1 hr, c = 10% in H2O |
| Quality Level | 200  |
| SMILES string | OC[C@@H](O)[C@@H](O)[C@H] |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| Biochem/physiol Actions: | D-Fructose is an important monosaccharide used in a wide range of applications. D-fructose is used in carbohydrate research, in organic and bioorganic synthesis; as a model compound; as a reference material, as an enzyme substrate and as a nutrient medium. |
| Biochem/physiol Actions: | It can be produced by separation from glucose and by hydrolysis (inversion) of sucrose.1 It also possess metabolic and endocrine impact that shows that increased consumption of fructose is a contributing factor in the development of obesity and the accompanying metabolic abnormalities observed in the insulin resistance syndrome. |
| General description: | D-Fructose (fruit sugar) is a reducing sugar. In fruits it is a very important sugar component, and mostly exists in free form in plants and often together with sucrose and D-glucose. It is a component of polysaccharide inulin and also a component of di-, tri- and oligo-saccharides. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (HPLC) |
| mp | 119-122 °C (dec.) (lit.) |
| UNSPSC | 41106212 |