Synonym: (+)-(S)-4,4′-Propylenedi-2,6-piperazinedione; (S)-(+)-1,2-Bis(3,5-dioxopiperazin-1-yl)propane; Cardioxane; ICRF-187; NSC169780; Zinecard
CAS Number: 24584-09-6
Empirical Formula (Hill Notation): C11H16N4O4
Molecular Weight: 268.27
MDL Number: MFCD00866449
Linear Formula: C11H16N4O4
Product Type: Chemical
| application(s) |
clinical testing |
| assay |
≥97.0% (GC) |
| format |
neat |
| grade |
analytical standard |
| InChI |
1S/C11H16N4O4/c1-7(15-5-10(18)13-11(19)6-15)2-14-3-8(16)12-9(17)4-14/h7H,2-6H2,1H3,(H,12,16,17)(H,13,18,19)/t7-/m0/s1 |
| InChI key |
BMKDZUISNHGIBY-ZETCQYMHSA-N |
| Quality Level |
100  |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
C[C@@H](CN1CC(=O)NC(=O)C1)N2CC(=O)NC(=O)C2 |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
Dexrazoxane is a cardioprotective compound against anthracyclines. It functions by inhibiting topoisomerase II without inducing DNA strand breaks. Dexrazoxane is a + enantiomer of razoxane. |
| Biochem/physiol Actions: |
Dexrazoxane is a cardioprotective compound used to counteract the effects of anthracyclines. Dexrazoxane is believed to function as a free radical scanenger. |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H315 - H319 - H335 |
| Precautionary statements |
P305 + P351 + P338 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥97.0% (GC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
41116107 |
