Trioctylphosphine oxide
SIAL/00676 - for extraction analysis, ≥98.5%
Synonym: (Oct)3PO; TOPO®
CAS Number: 78-50-2
Empirical Formula (Hill Notation): C24H51OP
Molecular Weight: 386.63
EC Number: 201-121-3
MDL Number: MFCD00002083
Linear Formula: [CH3(CH2)7]3PO
Product Type: Chemical
| assay | ≥98.5% |
| ≥98.5% (GC) | |
| bp | 201-202 °C/2 mmHg (lit.) |
| cation traces | Ca: ≤10 mg/kg |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤10 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Na: ≤10 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| functional group | phosphine oxide |
| impurities | ≤0.2% free acid (as H3PO4) |
| ≤0.5% water | |
| InChI | 1S/C24H51OP/c1-4-7-10-13- |
| InChI key | ZMBHCYHQLYEYDV-UHFFFAOYSA |
| mp | 50-52 °C (lit.) |
| 52-55 °C | |
| Quality Level | 200  |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction |
| reaction type: Heck Reaction | |
| reaction type: Hiyama Coupling | |
| reaction type: Negishi Coupling | |
| reaction type: Sonogashira Coupling | |
| reaction type: Stille Coupling | |
| reaction type: Suzuki-Miyaura Coupling | |
| reagent type: ligand | |
| SMILES string | CCCCCCCCP(=O)(CCCCCCCC)CC |
| Application: | Catalyst in: • Preparation of tetradentate planar-chiral hydroxy-substituted ferrocenecarboxaldimine Schiff base ligands • Reactions of allyl esters with hydrosilanes • Asymmetric cyanosilylation of aldehydes • Preparation of chlorothiol formates from thiols and phosgene |
| Legal Information: | TOPO is a registered trademark of Life Technologies |
| Symbol |  GHS05 |
| Signal word | Danger |
| Hazard statements | H315 - H318 |
| Precautionary statements | P280 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 38-41 |
| Safety Statements | 26-39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 230.0 °F - closed cup |
| Flash Point(C) | 110 °C - closed cup |
| Purity | ≥98.5% (GC); ≥98.5% |
| bp | 201-202 °C/2 mmHg (lit.) |
| mp | 50-52 °C (lit.); 52-55 °C |
| UNSPSC | 12352001 |