Synonym: 1,3,3-Trimethyl-2-oxabicyclo[2.2.2]octane; 1,8-Cineole; 1,8-Epoxy-p-menthane
CAS Number: 470-82-6
Empirical Formula (Hill Notation): C10H18O
Molecular Weight: 154.25
EC Number: 207-431-5
MDL Number: MFCD00167977
Linear Formula: C10H18O
Product Type: Chemical
This picture is provided solely for illustration purposes, it may have been created or edited with AI. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts W246506-SAMPLE-K.
| agency |
follows IFRA guidelines |
| |
meets purity specifications of JECFA |
| application(s) |
flavors and fragrances |
| assay |
≥99% |
| bp |
176-177 °C (lit.) |
| density |
0.921 g/mL at 25 °C (lit.) |
| documentation |
see Safety & Documentation for available documents |
| food allergen |
no known allergens |
| fragrance allergen |
limonene (sum of D, L and DL) |
| grade |
FG |
| |
Fragrance grade |
| |
Halal |
| |
Kosher |
| |
natural |
| InChI |
1S/C10H18O/c1-9(2)8-4-6-10(3,11-9)7-5-8/h8H,4-7H2,1-3H3/t8-,10+ |
| InChI key |
WEEGYLXZBRQIMU-WAAGHKOSSA-N |
| mp |
1-2 °C (lit.) |
| organoleptic |
camphoraceous; herbaceous; minty |
| Quality Level |
300  |
| |
400  |
| refractive index |
n20/D 1.457 (lit.) |
| reg. compliance |
EU Regulation 1223/2009 |
| |
EU Regulation 1334/2008 & 178/2002 |
| |
FCC |
| |
FDA 21 CFR 117 |
| SMILES string |
C[C@]12CC[C@H](CC1)C(C)(C)O2 |
| Biochem/physiol Actions: |
Taste at 30 ppm |
| Other Notes: |
Natural occurrence: Cardamom, cranberry, laurel, pepper, rosemary and sweet marjoram. |
| Packaging: |
1 kg in glass bottle |
| Packaging: |
10 kg in steel drum |
| Packaging: |
20 kg in composite drum |
| Symbol |
 GHS02,GHS07 |
| Signal word |
Warning |
| Hazard statements |
H226 - H317 |
| Precautionary statements |
P210 - P280 - P302 + P352 |
| Risk Statements |
10 |
| RIDADR |
UN 1993C 3 / PGIII |
| WGK Germany |
WGK 2 |
| Flash Point(F) |
125.6 °F - closed cup |
| Flash Point(C) |
52 °C - closed cup |
| Purity |
≥99% |
| bp |
176-177 °C (lit.) |
| mp |
1-2 °C (lit.) |
| Density |
0.921 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.457 (lit.) |
| FEMA Number |
2465 |
| UNSPSC |
12164502 |