Perfluorodecalin
ALDRICH/P9900 - 95%
Synonym: Octadecafluorodecahydronaphthalene (cis+trans); Perflunafene; Perfluorodecahydronaphthalene (cis+trans)
CAS Number: 306-94-5
Empirical Formula (Hill Notation): C10F18
Molecular Weight: 462.08
EC Number: 206-192-4
MDL Number: MFCD00010626
Linear Formula: C10F18
Product Type: Chemical
| assay | 95% |
| bp | 142 °C (lit.) |
| density | 1.908 g/mL at 25 °C (lit.) |
| InChI | 1S/C10F18/c11-1-2(12,5(17 |
| InChI key | UWEYRJFJVCLAGH-UHFFFAOYSA |
| mp | −10 °C (lit.) |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | FC1(F)C(F)(F)C(F)(F)C2(F) |
| vapor density | 17.5 (vs air) |
| Application: | Perfluorodecalin is a fluorous solvent generally used as a primary component of the fluorous biphasic system (FBS) or the fluorous multiphasic system (FMS) in synthetic chemistry. It is also used as an additive to increase oxygen solubility in fermentation media. |
| Packaging: | 25 g in ampule |
| Symbol | GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 138.2 °F |
| Flash Point(C) | 59 °C |
| Purity | 95% |
| bp | 142 °C (lit.) |
| mp | −10 °C (lit.) |
| Density | 1.908 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |


