mPEG6-Acrylate
ALDRICH/JKA13007
Linear Formula: CH3O(CH2CH2O)5CH2CH2OCOCHCH2
Product Type: Chemical
| form | solid |
| storage temp. | −20°C |
| Application: | Applications may include: bioconjugation, drug delivery, PEG hydrogel, crosslinker, and surface functionalization |
| Legal Information: | Product of JenKem Technology |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H319 |
| Precautionary statements | P301 + P312 + P330 - P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | −20°C |
| UNSPSC | 12352200 |

