mPEG12-Acrylate
ALDRICH/JKA13006
Linear Formula: CH3O(CH2CH2O)11CH2CH2OCOCHCH2
Product Type: Chemical
| form | liquid |
| polymer architecture | shape : linear functionality : monofunctional |
| reaction suitability | reagent type: chemical modification reagent reaction type: Polymerization Reactions |
| storage temp. | −20°C |
| Application: | Applications may include: bioconjugation, drug delivery, PEG hydrogel, crosslinker, and surface functionalization |
| General description: | Monodisperse PEG. It can react with amine and thiol. |
| Legal Information: | Product of JenKem Technology |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | −20°C |
| UNSPSC | 12162002 |
