1-Pyrenemethyl methacrylate
ALDRICH/765120 - contains ≤200 ppm MEHQ as inhibitor, 99% (GC)
Synonym: 1-Pyrenylmethyl methacrylate; Pyrene methacrylate; Pyrenylmethyl methacrylate
CAS Number: 86112-79-0
Empirical Formula (Hill Notation): C21H16O2
Molecular Weight: 300.35
MDL Number: MFCD00673248
Linear Formula: C21H16O2
Product Type: Chemical
| assay | 99% (GC) |
| contains | ≤200 ppm MEHQ as inhibitor |
| form | powder |
| InChI | 1S/C21H16O2/c1-13(2)21(22 |
| InChI key | BUQDPCFXOBQDLX-UHFFFAOYSA |
| mp | 100-105 °C |
| Quality Level | 100 ![]() |
| SMILES string | CC(=C)C(=O)OCc1ccc2ccc3cc |
| storage temp. | 2-8°C |
| Application: | • fluorescent monomer |
| Features and Benefits: | Water-soluble, thermo-responsive and responds to minor local environment changes. |
| General description: | 1-Pyrenemethyl methacrylate is a fluorescent methacrylate monomer which is used for synthesising poly methyl methacrylate (PMMA) based optical and fluorescent temperature sensors. These polymeric sensors exhibit reverse solubility transition wherein the polymer is insoluble at low temperatures and is soluble at higher temperatures. These sensors are used as biosensors, in drug delivery, logical gates and optical sensing applications. |
| Packaging: | 1 g in glass bottle |
| Symbol | GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273 - P391 - P501 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% (GC) |
| mp | 100-105 °C |
| Storage Temp. | 2-8°C |
| UNSPSC | 12162002 |


