Synonym: Maleimide PEG8 succinimidyl ester; 31-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-29-oxo-4,7,10,13,16,19,22,25-octaoxa-28-azahentriacontanoic acid 2,5-dioxo-1-pyrrolidinyl ester; Maleimide-PEG8-NHS ester; 31-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-29-oxo-4,7,10,13,16,19,22,25-octaoxa-28-azahentriacontanoic acid 2,5-dioxo-1-pyrrolidinyl ester; Maleimide-PEG8-NHS ester
CAS Number: 756525-93-6
Empirical Formula (Hill Notation): C30H47N3O15
Molecular Weight: 689.71
MDL Number: MFCD11041144
Linear Formula: C30H47N3O15
Product Type: Chemical
| form |
liquid |
| functional group |
maleimide |
| |
NHS ester |
| InChI |
1S/C30H47N3O15/c34-25(5-8-32-26(35)1-2-27(32)36)31-7-10-41-12-14-43-16-18-45-20-22-47-24-23-46-21-19-44-17-15-42-13-11-40-9-6-30(39)48-33-28(37)3-4-29(33)38/h1-2H,3-24H2,(H,31,34) |
| InChI key |
MTPWCXBUZLEBDD-UHFFFAOYSA-N |
| Quality Level |
100  |
| reaction suitability |
reaction type: Pegylations |
| |
reagent type: cross-linking reagent |
| SMILES string |
O=C(N1CCC(NCCOCCOCCOCCOCCOCCOCCOCCOCCC(ON2C(CCC2=O)=O)=O)=O)C=CC1=O |
| storage temp. |
−20°C |
| Application: |
Heterobifunctional crosslinker with an ethylene oxide spacer for linking amine- to sulfhydryl-containing compounds or biomolecules. Maleimide functional group will react with sulfhydryls and the succinimidyl ester group will react with amines. Spacer length is 39.2 angstroms. |
| Packaging: |
250 mg in amber glass bottle |
| Packaging: |
50 mg in clear glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Storage Temp. |
−20°C |
| UNSPSC |
12352108 |