Synonym: (S)-(−)-7,7′-Bis[di(3,5-dimethylphenyl)phosphino]-1,1′-spirobiindane; (S)-(−)-7,7′-Bis[di(3,5-dimethylphenyl)phosphino]-2,2′,3,3′-tetrahydro-1,1′-spirobiindene
CAS Number: 528521-89-3
Empirical Formula (Hill Notation): C49H50P2
Molecular Weight: 700.87
MDL Number: MFCD08459343
Linear Formula: C49H50P2
Product Type: Chemical
12 Principles of Green Chemistry: Principle 9—Catalytic reagents (as selective as possible) are superior to stoichiometric reagents.
| form |
solid |
| functional group |
phosphine |
| InChI |
1S/C49H50P2/c1-31-19-32(2)24-41(23-31)50(42-25-33(3)20-34(4)26-42)45-13-9-11-39-15-17-49(47(39)45)18-16-40-12-10-14-46(48(40)49)51(43-27-35(5)21-36(6)28-43)44-29-37(7)22-38(8)30-44/h9-14,19-30H,15-18H2,1-8H3 |
| InChI key |
AZSBNBQMIMQOPG-UHFFFAOYSA-N |
| mp |
>300 °C |
| optical activity |
[α]22/D −62.0°, c = 1 in chloroform |
| Quality Level |
100  |
| reaction suitability |
reagent type: ligand |
| SMILES string |
Cc1cc(C)cc(c1)P(c2cc(C)cc(C)c2)c3cccc4CCC5(CCc6cccc(P(c7cc(C)cc(C)c7)c8cc(C)cc(C)c8)c56)c34 |
| storage temp. |
−20°C |
| Packaging: |
50 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| mp |
>300 °C |
| Storage Temp. |
−20°C |
| UNSPSC |
12352002 |