2-(4,6-Diphenyl-1,3,5-triazin-2-yl)-5-[(hexyl)oxy]-phenol
ALDRICH/535826
Synonym: 2,4-
CAS Number: 147315-50-2
Empirical Formula (Hill Notation): C27H27N3O2
Molecular Weight: 425.52
EC Number: 411-380-6
MDL Number: MFCD02683454
Linear Formula: C27H27N3O2
Product Type: Chemical
| InChI | 1S/C27H27N3O2/c1-2-3-4-11 |
| InChI key | LEVFXWNQQSSNAC-UHFFFAOYSA |
| mp | 147-151 °C (lit.) |
| SMILES string | CCCCCCOc1ccc(c(O)c1)-c2nc |
| solubility | chloroform: 254 mg/mL at 20 °C |
| methyl methacrylate: 15 mg/mL at 20 °C | |
| methylene chloride: 169 mg/mL at 20 °C | |
| toluene: 51 mg/mL at 20 °C |
| Application: | Very low volatile UV light absorber and stabilizer. Allows polycarbonates and polyesters to achieve a higher resistance to weathering than conventional benzotriazole UV absorbers. Low tendency to chelate allows its use in polymer formulations containing catalyst residues. |
| Packaging: | 100 g in glass bottle |
| Hazard statements | H413 |
| Risk Statements | 53 |
| Safety Statements | 61 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| mp | 147-151 °C (lit.) |
| UNSPSC | 12162002 |
