Sulfonyl chloride, polymer-bound
ALDRICH/516228 - 70-90 mesh, extent of labeling: 2.5-3.0 mmol/g loading, 8.5 % cross-linked with divinylbenzene
CAS Number: 163894-16-4
MDL Number: MFCD00211665
Product Type: Chemical
| crosslinking | 8.5 % cross-linked with divinylbenzene |
| extent of labeling | 2.5-3.0 mmol/g loading |
| InChI | 1S/ClHO2S/c1-4(2)3/h4H |
| InChI key | JRZWKDKJYNXNGZ-UHFFFAOYSA |
| particle size | 70-90 mesh |
| Quality Level | 100 ![]() |
| reaction suitability | reaction type: solution phase peptide synthesis |
| reactivity: amine reactive | |
| SMILES string | C=Cc1ccccc1.ClS(=O)(=O)c2 |
| Application: | Reacts with nucleophiles |
| Packaging: | 5 g in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 12352202 |

