Glycerol propoxylate
ALDRICH/410284 - average Mn ~266
Synonym: Glycerol propoxylate (1PO/OH)
CAS Number: 25791-96-2
MDL Number: MFCD00132860
Linear Formula: HO(C3H6O)nCH[CH2(OC3H6)nOH]2
Product Type: Chemical
| density | 1.09 g/mL at 25 °C |
| form | liquid |
| InChI | 1S/C12H26O9/c13-5-9(16)1- |
| InChI key | ZSKSVMDBXFSLMZ-UHFFFAOYSA |
| mol wt | average Mn ~266 |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | O(C(OCCC(O)CO)OCCC(O)CO)C |
| solubility | H2O: soluble 1.000 g/L |
| vapor density | >1 (vs air) |
| vapor pressure | <0.3 mmHg ( 20 °C) |
| Application: | Glycerol propoxylate can be used as a macromonomer to prepare reusablegel oil sorbents for oil spill clean-up. |
| General description: | Glycerol propoxylate is a triol material with azig-zag structure having a polypropylene glycol unit with three hydroxy end groups. It is a hydrophobic macromonomer widely used in the preparation of crosslinked polymers due to the presence of multiple reaction sites in the branched structure. It can also be used as a plasticizer to impart good elasticity to the materials. |
| Packaging: | 1 L in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Density | 1.09 g/mL at 25 °C |
| Refractive Index | n |
| UNSPSC | 12162002 |

