3-Isopropenyl-α,α-dimethylbenzyl isocyanate
ALDRICH/361771 - 95%, contains ≤200 ppm BHT as inhibitor
Synonym: 3-Isopropenyl-α,α′-dimethylbenzyl isocyanate; m -Isoprenyl-α,α′-dimethylbenzyl isocyanate
CAS Number: 2094-99-7
Empirical Formula (Hill Notation): C13H15NO
Molecular Weight: 201.26
EC Number: 402-440-2
MDL Number: MFCD00080490
Linear Formula: H2C=C(CH3)C6H4C(CH3)2NCO
Product Type: Chemical
| assay | 95% |
| autoignition temp. | 838 °F |
| bp | 268-271 °C (lit.) |
| contains | ≤200 ppm BHT as inhibitor |
| density | 1.018 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C13H15NO/c1-10(2)11-6- |
| InChI key | ZVEMLYIXBCTVOF-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | CC(=C)c1cccc(c1)C(C)(C)N= |
| Application: | m-TMI can be used as a tetrafunctional isocyanate which can further be used in the development of polymer electrolyte. It can be used as a coupling agent in the preparation of jute reinforced polypropylene. |
| General description: | 3-Isopropenyl-α,α-dimethy |
| Packaging: | 1 L in glass bottle |
| Packaging: | 250 mL in glass bottle |
| Symbol | ![]() ![]() ![]() GHS05,GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H314 - H317 - H330 - H334 - H373 - H410 |
| Precautionary statements | P273 - P280 - P301 + P330 + P331 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 + P310 |
| Hazard Codes | T+,N |
| Risk Statements | 26-34-42/43-48/20-50/53 |
| Safety Statements | 7-15-28-36/37/39-38-45-60-61 |
| RIDADR | UN 2206PSN1B 6.1 / PGIII |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 95% |
| bp | 268-271 °C (lit.) |
| Density | 1.018 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12162002 |





