(1S,2R)-(+)-Norephedrine
ALDRICH/317500 - 98%
Synonym: (1S,2R)
CAS Number: 37577-28-9
Empirical Formula (Hill Notation): C9H13NO
Molecular Weight: 151.21
MDL Number: MFCD00064411
Linear Formula: C6H5CH(OH)CH(CH3)NH2
Product Type: Chemical
| assay | 98% |
| description | Drug Control: Pszichotróp anyag / Psychotropic Substance (Hungary), 78/2022. (XII. 28.) BM rendelet |
| drug control | Pszichotróp anyag / Psychotropic Substance (Hungary), 78/2022. (XII. 28.) BM rendelet |
| form | solid |
| functional group | amine |
| hydroxyl | |
| phenyl | |
| InChI | 1S/C9H13NO/c1-7(10)9(11)8 |
| InChI key | DLNKOYKMWOXYQA-VXNVDRBHSA |
| mp | 51-54 °C (lit.) |
| optical activity | [α]20/D +40°, c = 7 in 1 M HCl |
| Quality Level | 200 ![]() |
| SMILES string | C[C@@H](N)[C@@H](O)c1cccc |
| storage temp. | 2-8°C |
| Application: | (1S,2R)-(+)-Norephedrine may be used in the preparation of dendritic ligands, which on combining with Ru(II) complexes form efficient asymmetric transfer hydrogenation catalysts. It may also be used in the preparation of N-((1S,2R)-1-hydroxy-1-phenylpropa |
| General description: | (1S,2R)-(+)-Norephedrine is an enantiomer of ephedrine mainly used as a chiral auxiliary for asymmetric synthesis. |
| Packaging: | 10, 50 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H315 - H319 - H335 |
| Precautionary statements | P261 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 235.4 °F - closed cup |
| Flash Point(C) | 113 °C - closed cup |
| Purity | 98% |
| mp | 51-54 °C (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352116 |


