(+)-α-Pinene
ALDRICH/268070 - ≥99%
Synonym: (1R,5R)
CAS Number: 7785-70-8
Empirical Formula (Hill Notation): C10H16
Molecular Weight: 136.23
EC Number: 232-087-8
MDL Number: MFCD00001346
Linear Formula: C10H16
Product Type: Chemical
| assay | ≥99% |
| autoignition temp. | 491 °F |
| bp | 155-156 °C (lit.) |
| density | 0.858 g/mL at 20 °C (lit.) |
| form | liquid |
| InChI | 1S/C10H16/c1-7-4-5-8-6-9( |
| InChI key | GRWFGVWFFZKLTI-RKDXNWHRSA |
| mp | −62 °C (lit.) |
| optical activity | [α]21/D +50.7°, neat |
| optical purity | ee: 97% (GLC) |
| Quality Level | 100  |
| refractive index | n |
| SMILES string | CC1=CC[C@@H]2C[C@H]1C2(C) |
| Application: | (+)-α-Pinene may be used as precursors to prepare primary, secondary and tertiary γ-amino alcohols and 1,3-diamines, which can be used as chiral catalysts for the addition of diethylzinc to aromatic aldehydes, resulting in chiral 1-aryl-1-propanols with high enantioselectivity. |
| Application: | Employed in the preparation of chiral hydroboration reagents. |
| General description: | (+)-α-Pinene is a monoterpenoid compound mainly found in Pinus species. |
| Packaging: | 5, 25 g in glass bottle |
| Symbol |     GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H226 - H304 - H315 - H317 - H400 |
| Precautionary statements | P210 - P273 - P280 - P301 + P310 - P303 + P361 + P353 - P331 |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2368 3 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 91.4 °F - closed cup |
| Flash Point(C) | 33 °C - closed cup |
| Purity | ≥99% |
| bp | 155-156 °C (lit.) |
| mp | −62 °C (lit.) |
| Density | 0.858 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352002 |