Ethyl oleate
ALDRICH/268011 - 98%
Synonym: Oleic acid ethyl ester
CAS Number: 111-62-6
Empirical Formula (Hill Notation): C20H38O2
Molecular Weight: 310.51
EC Number: 203-889-5
MDL Number: MFCD00009579
Linear Formula: CH3(CH2)7CH=CH(CH2)7COOC2H5
Product Type: Chemical
| assay | 98% |
| bp | 216-218 °C/15 mmHg |
| density | 0.87 g/mL at 25 °C (lit.) |
| form | liquid |
| functional group | ester |
| InChI | 1S/C20H38O2/c1-3-5-6-7-8- |
| InChI key | LVGKNOAMLMIIKO-QXMHVHEDSA |
| mp | −32 °C (lit.) |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | CCCCCCCCC=C/CCCCCCCC(=O) |
| solubility | chloroform: soluble 10% |
| storage temp. | −20°C |
| Application: | Ethyl oleate can be used as a starting material to synthesize stearic acid hydrazide intermediate, which can undergo intermolecular cyclization reaction with various aliphatic acids and aromatic acids to yield 1,3,4-oxadiazole derivatives. It is also reduced to oleyl alcohol via Bouveault−Blanc reduction reaction. |
| Application: | Ethyl oleate was used to prepare the oily phase of self-microemulsifying drug delivery system (SMEDDS) for tacrolimus (Tac). |
| Packaging: | 25 g in poly bottle |
| Packaging: | 5 g in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| bp | 216-218 °C/15 mmHg |
| mp | −32 °C (lit.) |
| Density | 0.87 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | −20°C |
| UNSPSC | 12352100 |

