Synonym: (+)-Neomenthol; (1S,2S,5R)-2-Isopropyl-5-methylcyclohexanol; D-Neomenthol; [1S-(1β,2β,5α)]-5-Methyl-2-(1-methylethyl)cyclohexanol
CAS Number: 2216-52-6
Empirical Formula (Hill Notation): C10H20O
Molecular Weight: 156.27
EC Number: 218-691-4
MDL Number: MFCD00062980
Linear Formula: C10H20O
Product Type: Chemical
FT-IR Raman Spectra for (+)-Neomenthol.
FT-NMR Spectra for (+)-Neomenthol.
| assay |
≥95% |
| bp |
95 °C/12 mmHg (lit.) |
| density |
0.899 g/mL at 25 °C (lit.) |
| form |
liquid |
| functional group |
hydroxyl |
| InChI |
1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10+/m1/s1 |
| InChI key |
NOOLISFMXDJSKH-UTLUCORTSA-N |
| mp |
−22 °C (lit.) |
| optical activity |
[α]22/D +17.3°, neat |
| Quality Level |
100  |
| refractive index |
n20/D 1.461 (lit.) |
| SMILES string |
CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1O |
| storage temp. |
2-8°C |
| vapor pressure |
0.8 mmHg ( 20 °C) |
| General description: |
(1S,2S,5R)-(+)-Neomenthol is a monoterpenoid compound found in the peppermint herb, Mentha piperita L. This menthol isomer is generally used as an additive in oral hygiene products and as a flavoring agent in food and beverages. |
| Packaging: |
25 g in poly bottle |
| Packaging: |
5 g in glass bottle |
| Purity |
≥95% |
| bp |
95 °C/12 mmHg (lit.) |
| mp |
−22 °C (lit.) |
| Density |
0.899 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.461 (lit.) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352001 |