2-Hydroxy-5-nitrobenzyl bromide
ALDRICH/162906 - 90%
Synonym: α-Bromo-4-nitro-o-cresol; 2-
CAS Number: 772-33-8
Empirical Formula (Hill Notation): C7H6BrNO3
Molecular Weight: 232.03
EC Number: 212-248-9
MDL Number: MFCD00007340
Linear Formula: HOC6H3(NO2)CH2Br
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 162906-5G
| assay | 90% |
| form | solid |
| functional group | bromo |
| nitro | |
| InChI | 1S/C7H6BrNO3/c8-4-5-3-6(9 |
| InChI key | KFDPCYZHENQOBV-UHFFFAOYSA |
| mp | 144-149 °C (lit.) |
| SMILES string | Oc1ccc(cc1CBr)[N+]([O-])= |
| solubility | chloroform: soluble 25 mg/mL, clear, yellow |
| storage temp. | 2-8°C |
| Application: | 2-Hydroxy-5-nitrobenzyl bromide was used in covalent modification of tryptophan and tryptophan residues in monoclonal immunoglobulin. It was also used as reagent for sulfhydryl modification |
| General description: | 2-Hydroxy-5-nitrobenzyl bromide is a protein modifying reagent. |
| Other Notes: | Contains 2-hydroxy-5-nitrobenzyl alcohol |
| Packaging: | 5 g in glass bottle |
| Symbol |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260 - P280 - P301 + P330 + P331 - P303 + P361 + P353 - P305 + P351 + P338 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 90% |
| mp | 144-149 °C (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352100 |