Anthraquinone-2-sulfonic acid sodium salt monohydrate
ALDRICH/123242 - 97%
Synonym: 9,10-
CAS Number: 153277-35-1
Empirical Formula (Hill Notation): C14H7NaO5S · H2O
Molecular Weight: 328.27
EC Number: 205-009-5
MDL Number: MFCD00149068
Linear Formula: C14H7NaO5S · H2O
Product Type: Chemical
| assay | 97% |
| functional group | ketone |
| sulfonic acid | |
| impurities | 4.0-6.0% water (Karl Fischer) |
| InChI | 1S/C14H8O5S.Na.H2O/c15-13 |
| InChI key | KHILLYASAGTPOI-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | O.[Na+].[O-]S(=O)(=O)c1cc |
| Application: | Anthraquinone-2-sulfonic acid sodium salt monohydrate was used to investigate the effects of reactant concentration and synthesis parameters on the electrical conductivity of polypyrrole coated polyethyleneterephthalate fabrics. It has been used as dopant in the preparation of polypyrrole films by electrochemical polymerization. |
| General description: | Anthraquinone-2-sulfonic acid sodium salt monohydrate forms charge-transfer complexes with 9,10-dimethoxyanthracene- Anthraquinone-2-sulfonic acid sodium salt monohydrate can be used as a redox indicator to enhance the sensitivity and selectivity of the DNA biosensor. |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 100 g in poly bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97% |
| UNSPSC | 12352100 |


