Synonym: 1,4-Dihydroxy-2,5-di-tert-butylbenzene; 2,5-Bis(1,1-dimethylethyl)-1,4-benzenediol; 2,5-Di-tert-butyl-1,4-benzenediol; 2,5-Di-tert-butyl-1,4-benzohydroquinone; 2,5-Di-tert-butyl-1,4-dihydroxybenzene; 2,5-Di-tert-butylquinol; 2,5-Dihydroxy-1,4-di-tert-butylbenzene; 2,5-Ditert-butylbenzene-1,4-diol; 3,6-Di-tert-butylhydroquinone
CAS Number: 88-58-4
Empirical Formula (Hill Notation): C14H22O2
Molecular Weight: 222.32
EC Number: 201-841-8
MDL Number: MFCD00008825
Linear Formula: [(CH3)3C]2C6H2-1,4-(OH)2
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: 112976-1KG
| assay |
99% |
| autoignition temp. |
790 °F |
| form |
solid |
| InChI |
1S/C14H22O2/c1-13(2,3)9-7-12(16)10(8-11(9)15)14(4,5)6/h7-8,15-16H,1-6H3 |
| InChI key |
JZODKRWQWUWGCD-UHFFFAOYSA-N |
| mp |
216-218 °C (lit.) |
| Quality Level |
200  |
| SMILES string |
CC(C)(C)c1cc(O)c(cc1O)C(C)(C)C |
| Application: |
2,5-Di-tert-butylhydroquinone is the oxidation substrate used to measure the catalytic activity of the copper(II) enzyme-like catalysts. |
| Biochem/physiol Actions: |
2,5-Di-tert-butylhydroquinone specifically inhibits the sarcoplasmic reticulum (SR) Ca2+ uptake in the rat ventricle. |
| Biochem/physiol Actions: |
Blocks calcium-dependent insulin signaling in human beta cells |
| Packaging: |
1 kg in poly bottle |
| Packaging: |
25, 500 g in poly bottle |
| Purity |
99% |
| mp |
216-218 °C (lit.) |
| UNSPSC |
12352100 |